(2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid
Modify Date: 2025-09-09 15:37:20
(2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid structure
|
Common Name | (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 2096334-56-2 | Molecular Weight | 269.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16BNO3 |
|---|---|
| Molecular Weight | 269.11 |
| InChIKey | KVFNGJNVNRHWRJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccccc2B(O)O)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: CAS number of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is 2096334-56-2. |
| Q: What is the molecular formula of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: Molecular formula of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is C15H16BNO3. |
| Q: What is the English name of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: The English name of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid. |
| Q: What is the SMILES notation of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: SMILES notation of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is Cc1ccc(NC(=O)c2ccccc2B(O)O)c(C)c1. |
| Q: What is the molecular weight of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: Molecular weight of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is 269.11. |
| Q: What is the Chinese name of 2096334-56-2? |
| A: Chinese name of 2096334-56-2 is 2096334-56-2. |
| Q: What is the InChIKey of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid? |
| A: InChIKey of (2-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid is KVFNGJNVNRHWRJ-UHFFFAOYSA-N. |