Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]
Modify Date: 2026-08-03 19:37:27
![Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] Structure](https://www.chemsrc.com/extcaspic/158/2096337-38-9.png)
Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] structure
|
Common Name | Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] | ||
|---|---|---|---|---|
| CAS Number | 2096337-38-9 | Molecular Weight | 512.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8BBr3ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8BBr3ClNO3 |
|---|---|
| Molecular Weight | 512.2 |
| InChIKey | AHEICYYOWMPEOX-UHFFFAOYSA-N |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)c1ccc(Cl)c(B(O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: Molecular formula of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is C13H8BBr3ClNO3. |
| Q: What is the Chinese name of 2096337-38-9? |
| A: Chinese name of 2096337-38-9 is 2096337-38-9. |
| Q: What is the InChIKey of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: InChIKey of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is AHEICYYOWMPEOX-UHFFFAOYSA-N. |
| Q: What is the CAS number of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: CAS number of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is 2096337-38-9. |
| Q: What is the SMILES notation of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: SMILES notation of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is O=C(Nc1c(Br)cc(Br)cc1Br)c1ccc(Cl)c(B(O)O)c1. |
| Q: What is the molecular weight of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: Molecular weight of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is 512.2. |
| Q: What is the English name of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]? |
| A: The English name of Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl] is Boronic acid, B-[2-chloro-5-[[(2,4,6-tribromophenyl)amino]carbonyl]phenyl]. |