2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane
Modify Date: 2026-07-22 17:12:21
2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane structure
|
Common Name | 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane | ||
|---|---|---|---|---|
| CAS Number | 2096998-32-0 | Molecular Weight | 313.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18BBrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18BBrO3 |
|---|---|
| Molecular Weight | 313.00 |
| InChIKey | YAAOEYNLANBYMM-UHFFFAOYSA-N |
| SMILES | COc1ccc(B2OC(C)CC(C)(C)O2)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: The English name of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane. |
| Q: What is the molecular formula of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: Molecular formula of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is C13H18BBrO3. |
| Q: What is the SMILES notation of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: SMILES notation of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is COc1ccc(B2OC(C)CC(C)(C)O2)cc1Br. |
| Q: What is the Chinese name of 2096998-32-0? |
| A: Chinese name of 2096998-32-0 is 2096998-32-0. |
| Q: What is the CAS number of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: CAS number of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is 2096998-32-0. |
| Q: What is the molecular weight of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: Molecular weight of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is 313.00. |
| Q: What is the InChIKey of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane? |
| A: InChIKey of 2-(3-Bromo-4-methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is YAAOEYNLANBYMM-UHFFFAOYSA-N. |