Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate
Modify Date: 2026-08-26 18:31:00
![Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate Structure](https://www.chemsrc.com/extcaspic/045/2097133-37-2.png)
Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate structure
|
Common Name | Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2097133-37-2 | Molecular Weight | 258.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22O5 |
|---|---|
| Molecular Weight | 258.31 |
| InChIKey | MVLFRMOMZCYYJM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(OCC)CCC2(CC1)OCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: The English name of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate. |
| Q: What is the SMILES notation of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: SMILES notation of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is CCOC(=O)C1(OCC)CCC2(CC1)OCCO2. |
| Q: What is the molecular weight of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: Molecular weight of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is 258.31. |
| Q: What is the Chinese name of 2097133-37-2? |
| A: Chinese name of 2097133-37-2 is 2097133-37-2. |
| Q: What is the InChIKey of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: InChIKey of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is MVLFRMOMZCYYJM-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: CAS number of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is 2097133-37-2. |
| Q: What is the molecular formula of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate? |
| A: Molecular formula of Ethyl 8-ethoxy-1,4-dioxaspiro[4.5]decane-8-carboxylate is C13H22O5. |