1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester
Modify Date: 2026-08-16 10:52:42
1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester structure
|
Common Name | 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2097133-44-1 | Molecular Weight | 214.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18O4 |
|---|---|
| Molecular Weight | 214.26 |
| InChIKey | UZLALWOVYQHYSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(OCC)CCC(=O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: InChIKey of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is UZLALWOVYQHYSG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: Molecular weight of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is 214.26. |
| Q: What is the CAS number of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: CAS number of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is 2097133-44-1. |
| Q: What is the English name of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: The English name of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester. |
| Q: What is the molecular formula of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: Molecular formula of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is C11H18O4. |
| Q: What is the Chinese name of 2097133-44-1? |
| A: Chinese name of 2097133-44-1 is 2097133-44-1. |
| Q: What is the SMILES notation of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester? |
| A: SMILES notation of 1-Ethoxy-4-oxocyclohexanecarboxylic acid ethyl ester is CCOC(=O)C1(OCC)CCC(=O)CC1. |