1,3-Dibutyl acetylcitrate
Modify Date: 2025-08-28 16:07:08
1,3-Dibutyl acetylcitrate structure
|
Common Name | 1,3-Dibutyl acetylcitrate | ||
|---|---|---|---|---|
| CAS Number | 2097561-45-8 | Molecular Weight | 346.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dibutyl acetylcitrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26O8 |
|---|---|
| Molecular Weight | 346.37 |
| InChIKey | AXPPLWQNWVZZNB-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-Dibutyl acetylcitrate? |
| A: Molecular weight of 1,3-Dibutyl acetylcitrate is 346.37. |
| Q: What is the InChIKey of 1,3-Dibutyl acetylcitrate? |
| A: InChIKey of 1,3-Dibutyl acetylcitrate is AXPPLWQNWVZZNB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,3-Dibutyl acetylcitrate? |
| A: SMILES notation of 1,3-Dibutyl acetylcitrate is CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)O. |
| Q: What is the Chinese name of 2097561-45-8? |
| A: Chinese name of 2097561-45-8 is 2097561-45-8. |
| Q: What is the English name of 1,3-Dibutyl acetylcitrate? |
| A: The English name of 1,3-Dibutyl acetylcitrate is 1,3-Dibutyl acetylcitrate. |
| Q: What is the CAS number of 1,3-Dibutyl acetylcitrate? |
| A: CAS number of 1,3-Dibutyl acetylcitrate is 2097561-45-8. |
| Q: What is the molecular formula of 1,3-Dibutyl acetylcitrate? |
| A: Molecular formula of 1,3-Dibutyl acetylcitrate is C16H26O8. |