N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide
Modify Date: 2026-07-08 17:42:35
![N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide Structure](https://www.chemsrc.com/extcaspic/080/2097872-69-8.png)
N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide structure
|
Common Name | N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2097872-69-8 | Molecular Weight | 315.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO4 |
|---|---|
| Molecular Weight | 315.4 |
| InChIKey | RRMCRKZCWCBVCQ-UHFFFAOYSA-N |
| SMILES | O=C(NCC(O)c1ccc(-c2ccco2)cc1)C1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: Molecular formula of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is C18H21NO4. |
| Q: What is the Chinese name of 2097872-69-8? |
| A: Chinese name of 2097872-69-8 is 2097872-69-8. |
| Q: What is the molecular weight of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: Molecular weight of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is 315.4. |
| Q: What is the English name of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: The English name of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide. |
| Q: What is the CAS number of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: CAS number of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is 2097872-69-8. |
| Q: What is the InChIKey of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: InChIKey of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is RRMCRKZCWCBVCQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide? |
| A: SMILES notation of N-{2-[4-(furan-2-yl)phenyl]-2-hydroxyethyl}oxane-4-carboxamide is O=C(NCC(O)c1ccc(-c2ccco2)cc1)C1CCOCC1. |