3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide
Modify Date: 2026-08-03 21:03:10
![3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide Structure](https://www.chemsrc.com/extcaspic/375/2097909-28-7.png)
3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide structure
|
Common Name | 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide | ||
|---|---|---|---|---|
| CAS Number | 2097909-28-7 | Molecular Weight | 321.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20FNO2S |
|---|---|
| Molecular Weight | 321.4 |
| InChIKey | DWJIKBWNAUHMQW-UHFFFAOYSA-N |
| SMILES | CC(O)(CNC(=O)CCc1ccccc1F)Cc1ccsc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: The English name of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide. |
| Q: What is the InChIKey of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: InChIKey of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is DWJIKBWNAUHMQW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: Molecular formula of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is C17H20FNO2S. |
| Q: What is the SMILES notation of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: SMILES notation of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is CC(O)(CNC(=O)CCc1ccccc1F)Cc1ccsc1. |
| Q: What is the Chinese name of 2097909-28-7? |
| A: Chinese name of 2097909-28-7 is 2097909-28-7. |
| Q: What is the CAS number of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: CAS number of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is 2097909-28-7. |
| Q: What is the molecular weight of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide? |
| A: Molecular weight of 3-(2-fluorophenyl)-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}propanamide is 321.4. |