(E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide
Modify Date: 2025-09-09 13:38:04
![(E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide Structure](https://www.chemsrc.com/extcaspic/155/2097939-98-3.png)
(E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide structure
|
Common Name | (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide | ||
|---|---|---|---|---|
| CAS Number | 2097939-98-3 | Molecular Weight | 349.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H15N3O4 |
|---|---|
| Molecular Weight | 349.3 |
| InChIKey | UFOSRCZSCLIUDR-GQCTYLIASA-N |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCc1nccnc1-c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: Molecular formula of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is C19H15N3O4. |
| Q: What is the CAS number of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: CAS number of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is 2097939-98-3. |
| Q: What is the InChIKey of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: InChIKey of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is UFOSRCZSCLIUDR-GQCTYLIASA-N. |
| Q: What is the molecular weight of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: Molecular weight of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is 349.3. |
| Q: What is the SMILES notation of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: SMILES notation of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is O=C(C=Cc1ccc2c(c1)OCO2)NCc1nccnc1-c1ccco1. |
| Q: What is the English name of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide? |
| A: The English name of (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide is (E)-3-(benzo[d][1,3]dioxol-5-yl)-N-((3-(furan-2-yl)pyrazin-2-yl)methyl)acrylamide. |
| Q: What is the Chinese name of 2097939-98-3? |
| A: Chinese name of 2097939-98-3 is 2097939-98-3. |