(2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide
Modify Date: 2025-09-01 12:30:52
![(2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide Structure](https://www.chemsrc.com/extcaspic/405/2097940-29-7.png)
(2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide structure
|
Common Name | (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2097940-29-7 | Molecular Weight | 379.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H25N3O4S |
|---|---|
| Molecular Weight | 379.5 |
| InChIKey | JFXQATCGRVTFEW-ZZXKWVIFSA-N |
| SMILES | CNC(=O)C=CCNC(=O)C1CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: Molecular formula of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is C18H25N3O4S. |
| Q: What is the English name of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: The English name of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide. |
| Q: What is the CAS number of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: CAS number of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is 2097940-29-7. |
| Q: What is the SMILES notation of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: SMILES notation of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is CNC(=O)C=CCNC(=O)C1CCCN(S(=O)(=O)c2ccc(C)cc2)C1. |
| Q: What is the molecular weight of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: Molecular weight of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is 379.5. |
| Q: What is the InChIKey of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide? |
| A: InChIKey of (2E)-N-methyl-4-{[1-(4-methylbenzenesulfonyl)piperidin-3-yl]formamido}but-2-enamide is JFXQATCGRVTFEW-ZZXKWVIFSA-N. |
| Q: What is the Chinese name of 2097940-29-7? |
| A: Chinese name of 2097940-29-7 is 2097940-29-7. |