Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride
Modify Date: 2026-07-07 21:59:51
Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride structure
|
Common Name | Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2097944-96-0 | Molecular Weight | 215.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H12ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H12ClF2NO2 |
|---|---|
| Molecular Weight | 215.62 |
| InChIKey | AASZJOIMYAOQLE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)C1CC(F)(F)C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2097944-96-0? |
| A: Chinese name of 2097944-96-0 is 2097944-96-0. |
| Q: What is the English name of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: The English name of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride. |
| Q: What is the CAS number of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: CAS number of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is 2097944-96-0. |
| Q: What is the SMILES notation of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: SMILES notation of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is COC(=O)C(N)C1CC(F)(F)C1.Cl. |
| Q: What is the molecular formula of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: Molecular formula of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is C7H12ClF2NO2. |
| Q: What is the molecular weight of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: Molecular weight of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is 215.62. |
| Q: What is the InChIKey of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride? |
| A: InChIKey of Methyl 2-amino-2-(3,3-difluorocyclobutyl)acetate hydrochloride is AASZJOIMYAOQLE-UHFFFAOYSA-N. |