(1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine
Modify Date: 2025-09-09 18:54:53
(1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine structure
|
Common Name | (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 2097948-43-9 | Molecular Weight | 222.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N4 |
|---|---|
| Molecular Weight | 222.33 |
| InChIKey | XWQCDCXHVLTVHV-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(C)c1CN1CCC(CN)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: SMILES notation of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is Cc1n[nH]c(C)c1CN1CCC(CN)CC1. |
| Q: What is the English name of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: The English name of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine. |
| Q: What is the molecular formula of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: Molecular formula of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is C12H22N4. |
| Q: What is the InChIKey of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: InChIKey of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is XWQCDCXHVLTVHV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2097948-43-9? |
| A: Chinese name of 2097948-43-9 is 2097948-43-9. |
| Q: What is the CAS number of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: CAS number of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is 2097948-43-9. |
| Q: What is the molecular weight of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine? |
| A: Molecular weight of (1-((3,5-dimethyl-1H-pyrazol-4-yl)methyl)piperidin-4-yl)methanamine is 222.33. |