2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid
Modify Date: 2026-08-07 10:42:19
2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid structure
|
Common Name | 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2097950-95-1 | Molecular Weight | 215.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO3 |
|---|---|
| Molecular Weight | 215.29 |
| InChIKey | RTNUNOOAIWZNQA-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)N1CCCCC1C(C)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: Molecular formula of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is C11H21NO3. |
| Q: What is the SMILES notation of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: SMILES notation of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is CCC(C(=O)O)N1CCCCC1C(C)O. |
| Q: What is the Chinese name of 2097950-95-1? |
| A: Chinese name of 2097950-95-1 is 2097950-95-1. |
| Q: What is the English name of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: The English name of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid. |
| Q: What is the CAS number of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: CAS number of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is 2097950-95-1. |
| Q: What is the molecular weight of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: Molecular weight of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is 215.29. |
| Q: What is the InChIKey of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid? |
| A: InChIKey of 2-(2-(1-Hydroxyethyl)piperidin-1-yl)butanoic acid is RTNUNOOAIWZNQA-UHFFFAOYSA-N. |