Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate
Modify Date: 2026-07-16 11:16:43
Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate structure
|
Common Name | Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 2097951-88-5 | Molecular Weight | 296.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19F3N2O3 |
|---|---|
| Molecular Weight | 296.29 |
| InChIKey | RGKVIMVACDJHKX-UHFFFAOYSA-N |
| SMILES | CC1CCN(C(=O)C2CNC2)CC1.O=C(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: CAS number of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is 2097951-88-5. |
| Q: What is the InChIKey of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: InChIKey of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is RGKVIMVACDJHKX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2097951-88-5? |
| A: Chinese name of 2097951-88-5 is 2097951-88-5. |
| Q: What is the molecular formula of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: Molecular formula of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is C12H19F3N2O3. |
| Q: What is the SMILES notation of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: SMILES notation of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is CC1CCN(C(=O)C2CNC2)CC1.O=C(O)C(F)(F)F. |
| Q: What is the English name of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: The English name of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate. |
| Q: What is the molecular weight of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate? |
| A: Molecular weight of Azetidin-3-yl(4-methylpiperidin-1-yl)methanone 2,2,2-trifluoroacetate is 296.29. |