N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate
Modify Date: 2026-07-04 10:35:01
N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate structure
|
Common Name | N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 2097951-90-9 | Molecular Weight | 254.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13F3N2O3 |
|---|---|
| Molecular Weight | 254.21 |
| InChIKey | PMKCJALWWRTSQH-UHFFFAOYSA-N |
| SMILES | O=C(NC1CC1)C1CNC1.O=C(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: Molecular formula of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is C9H13F3N2O3. |
| Q: What is the InChIKey of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: InChIKey of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is PMKCJALWWRTSQH-UHFFFAOYSA-N. |
| Q: What is the English name of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: The English name of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate. |
| Q: What is the molecular weight of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: Molecular weight of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is 254.21. |
| Q: What is the Chinese name of 2097951-90-9? |
| A: Chinese name of 2097951-90-9 is 2097951-90-9. |
| Q: What is the SMILES notation of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: SMILES notation of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is O=C(NC1CC1)C1CNC1.O=C(O)C(F)(F)F. |
| Q: What is the CAS number of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate? |
| A: CAS number of N-cyclopropylazetidine-3-carboxamide 2,2,2-trifluoroacetate is 2097951-90-9. |