4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one
Modify Date: 2025-09-09 19:57:01
![4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one Structure](https://www.chemsrc.com/extcaspic/118/2097953-27-8.png)
4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one structure
|
Common Name | 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one | ||
|---|---|---|---|---|
| CAS Number | 2097953-27-8 | Molecular Weight | 210.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18N2O2 |
|---|---|
| Molecular Weight | 210.27 |
| InChIKey | WVKLEPROTCJUQG-UHFFFAOYSA-N |
| SMILES | O=C1N(C2CC2)CCOC12CCCNC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: Molecular weight of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is 210.27. |
| Q: What is the InChIKey of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: InChIKey of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is WVKLEPROTCJUQG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: Molecular formula of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is C11H18N2O2. |
| Q: What is the CAS number of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: CAS number of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is 2097953-27-8. |
| Q: What is the Chinese name of 2097953-27-8? |
| A: Chinese name of 2097953-27-8 is 2097953-27-8. |
| Q: What is the SMILES notation of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: SMILES notation of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is O=C1N(C2CC2)CCOC12CCCNC2. |
| Q: What is the English name of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one? |
| A: The English name of 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one is 4-Cyclopropyl-1-oxa-4,8-diazaspiro[5.5]undecan-5-one. |