2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile
Modify Date: 2026-07-08 21:17:45
![2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile Structure](https://www.chemsrc.com/extcaspic/036/2097959-80-1.png)
2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile structure
|
Common Name | 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 2097959-80-1 | Molecular Weight | 204.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N4 |
|---|---|
| Molecular Weight | 204.27 |
| InChIKey | KLOYCJOLFMBZER-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc(NCC#N)ncn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: Molecular weight of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is 204.27. |
| Q: What is the CAS number of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: CAS number of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is 2097959-80-1. |
| Q: What is the Chinese name of 2097959-80-1? |
| A: Chinese name of 2097959-80-1 is 2097959-80-1. |
| Q: What is the InChIKey of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: InChIKey of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is KLOYCJOLFMBZER-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: Molecular formula of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is C11H16N4. |
| Q: What is the SMILES notation of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: SMILES notation of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is CCC(C)(C)c1cc(NCC#N)ncn1. |
| Q: What is the English name of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile? |
| A: The English name of 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile is 2-{[6-(2-Methylbutan-2-yl)pyrimidin-4-yl]amino}acetonitrile. |