1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde
Modify Date: 2025-09-10 07:56:00
![1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde Structure](https://www.chemsrc.com/extcaspic/122/2097965-31-4.png)
1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde structure
|
Common Name | 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2097965-31-4 | Molecular Weight | 237.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N3O |
|---|---|
| Molecular Weight | 237.26 |
| InChIKey | SVVODOSJSSBJFG-UHFFFAOYSA-N |
| SMILES | O=Cc1cn(Cc2ccc3ccccc3c2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: SMILES notation of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is O=Cc1cn(Cc2ccc3ccccc3c2)nn1. |
| Q: What is the English name of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: The English name of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde. |
| Q: What is the InChIKey of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: InChIKey of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is SVVODOSJSSBJFG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: CAS number of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is 2097965-31-4. |
| Q: What is the molecular weight of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: Molecular weight of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is 237.26. |
| Q: What is the molecular formula of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde? |
| A: Molecular formula of 1-[(naphthalen-2-yl)methyl]-1H-1,2,3-triazole-4-carbaldehyde is C14H11N3O. |
| Q: What is the Chinese name of 2097965-31-4? |
| A: Chinese name of 2097965-31-4 is 2097965-31-4. |