methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate
Modify Date: 2025-09-09 22:26:06
methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2097965-43-8 | Molecular Weight | 241.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11N3O5 |
|---|---|
| Molecular Weight | 241.20 |
| InChIKey | AKNGARFEIIILJO-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)Cn1cc(C(=O)OC)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is 241.20. |
| Q: What is the English name of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the CAS number of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is 2097965-43-8. |
| Q: What is the InChIKey of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is AKNGARFEIIILJO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is COC(=O)CC(=O)Cn1cc(C(=O)OC)nn1. |
| Q: What is the molecular formula of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of methyl 1-(4-methoxy-2,4-dioxobutyl)-1H-1,2,3-triazole-4-carboxylate is C9H11N3O5. |
| Q: What is the Chinese name of 2097965-43-8? |
| A: Chinese name of 2097965-43-8 is 2097965-43-8. |