4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline
Modify Date: 2025-09-09 17:02:40
4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline structure
|
Common Name | 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 2097975-62-5 | Molecular Weight | 222.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19FN2 |
|---|---|
| Molecular Weight | 222.30 |
| InChIKey | ARFMLVDSIVEQAW-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2CNCC2CF)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: CAS number of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is 2097975-62-5. |
| Q: What is the molecular weight of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: Molecular weight of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is 222.30. |
| Q: What is the molecular formula of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: Molecular formula of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is C13H19FN2. |
| Q: What is the SMILES notation of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: SMILES notation of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is CN(C)c1ccc(C2CNCC2CF)cc1. |
| Q: What is the InChIKey of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: InChIKey of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is ARFMLVDSIVEQAW-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline? |
| A: The English name of 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline is 4-(4-(fluoromethyl)pyrrolidin-3-yl)-N,N-dimethylaniline. |
| Q: What is the Chinese name of 2097975-62-5? |
| A: Chinese name of 2097975-62-5 is 2097975-62-5. |