2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one
Modify Date: 2026-09-27 07:37:56
![2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one Structure](https://www.chemsrc.com/extcaspic/155/2097976-31-1.png)
2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one structure
|
Common Name | 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 2097976-31-1 | Molecular Weight | 232.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N4O |
|---|---|
| Molecular Weight | 232.28 |
| InChIKey | UOSHKWZECPUMFM-UHFFFAOYSA-N |
| SMILES | NCCn1ccn2nc3c(c2c1=O)CCCC3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2097976-31-1? |
| A: Chinese name of 2097976-31-1 is 2097976-31-1. |
| Q: What is the InChIKey of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: InChIKey of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is UOSHKWZECPUMFM-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: The English name of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one. |
| Q: What is the SMILES notation of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: SMILES notation of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is NCCn1ccn2nc3c(c2c1=O)CCCC3. |
| Q: What is the CAS number of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: CAS number of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is 2097976-31-1. |
| Q: What is the molecular weight of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: Molecular weight of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is 232.28. |
| Q: What is the molecular formula of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one? |
| A: Molecular formula of 2-(2-aminoethyl)-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1(2H)-one is C12H16N4O. |