1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione
Modify Date: 2026-09-11 12:43:01
1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione structure
|
Common Name | 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 2097993-30-9 | Molecular Weight | 238.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F2N2O2 |
|---|---|
| Molecular Weight | 238.19 |
| InChIKey | NFPMGTGQCCDCCS-UHFFFAOYSA-N |
| SMILES | O=c1[nH]ccn(Cc2cc(F)ccc2F)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: InChIKey of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is NFPMGTGQCCDCCS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: SMILES notation of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is O=c1[nH]ccn(Cc2cc(F)ccc2F)c1=O. |
| Q: What is the molecular formula of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: Molecular formula of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is C11H8F2N2O2. |
| Q: What is the molecular weight of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: Molecular weight of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is 238.19. |
| Q: What is the CAS number of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: CAS number of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is 2097993-30-9. |
| Q: What is the Chinese name of 2097993-30-9? |
| A: Chinese name of 2097993-30-9 is 2097993-30-9. |
| Q: What is the English name of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione? |
| A: The English name of 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione is 1-(2,5-Difluorobenzyl)-1,4-dihydropyrazine-2,3-dione. |