5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one
Modify Date: 2026-07-22 18:25:45
![5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one Structure](https://www.chemsrc.com/extcaspic/411/2097993-57-0.png)
5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one structure
|
Common Name | 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 2097993-57-0 | Molecular Weight | 228.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N4O |
|---|---|
| Molecular Weight | 228.25 |
| InChIKey | JKUZXDGSLCLKJM-UHFFFAOYSA-N |
| SMILES | NCCn1c(=O)c2cccn2c2cccnc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: Molecular formula of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is C12H12N4O. |
| Q: What is the Chinese name of 2097993-57-0? |
| A: Chinese name of 2097993-57-0 is 2097993-57-0. |
| Q: What is the SMILES notation of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: SMILES notation of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is NCCn1c(=O)c2cccn2c2cccnc21. |
| Q: What is the CAS number of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: CAS number of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is 2097993-57-0. |
| Q: What is the English name of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: The English name of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one. |
| Q: What is the InChIKey of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: InChIKey of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is JKUZXDGSLCLKJM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one? |
| A: Molecular weight of 5-(2-aminoethyl)pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6(5H)-one is 228.25. |