4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid
Modify Date: 2026-07-17 17:19:36
![4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/083/2097993-97-8.png)
4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid structure
|
Common Name | 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2097993-97-8 | Molecular Weight | 235.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.28 |
| InChIKey | ASMJBSCLIOHVBM-UHFFFAOYSA-N |
| SMILES | CCCN1CCOc2ccc(C(=O)O)cc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2097993-97-8? |
| A: Chinese name of 2097993-97-8 is 2097993-97-8. |
| Q: What is the molecular formula of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: Molecular formula of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is C13H17NO3. |
| Q: What is the English name of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: The English name of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid. |
| Q: What is the InChIKey of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: InChIKey of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is ASMJBSCLIOHVBM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: SMILES notation of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is CCCN1CCOc2ccc(C(=O)O)cc2C1. |
| Q: What is the CAS number of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: CAS number of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is 2097993-97-8. |
| Q: What is the molecular weight of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid? |
| A: Molecular weight of 4-Propyl-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine-7-carboxylic acid is 235.28. |