Piperazine, 1-(4-dimethylamino-2-pyrimidinyl)-4-(3,3,3-triphenylpropyl )- structure
|
Common Name | Piperazine, 1-(4-dimethylamino-2-pyrimidinyl)-4-(3,3,3-triphenylpropyl )- | ||
|---|---|---|---|---|
| CAS Number | 20980-17-0 | Molecular Weight | 477.64300 | |
| Density | 1.139g/cm3 | Boiling Point | 663ºC at 760mmHg | |
| Molecular Formula | C31H35N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.7ºC | |
| Name | N,N-dimethyl-2-[4-(3,3,3-triphenylpropyl)piperazin-1-yl]pyrimidin-4-amine |
|---|
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 663ºC at 760mmHg |
| Molecular Formula | C31H35N5 |
| Molecular Weight | 477.64300 |
| Flash Point | 354.7ºC |
| Exact Mass | 477.28900 |
| PSA | 35.50000 |
| LogP | 5.09220 |
| Vapour Pressure | 1.91E-17mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | AXVBJXVSFUOBFI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccnc(N2CCN(CCC(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |