4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine
Modify Date: 2025-09-09 18:47:06
![4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine Structure](https://www.chemsrc.com/extcaspic/489/2098009-57-3.png)
4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine structure
|
Common Name | 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2098009-57-3 | Molecular Weight | 238.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4ClFN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H4ClFN2S |
|---|---|
| Molecular Weight | 238.67 |
| InChIKey | BVLXNKPEXNGKQD-UHFFFAOYSA-N |
| SMILES | Fc1cccc2c1sc1c(Cl)ncnc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: The English name of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine. |
| Q: What is the SMILES notation of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: SMILES notation of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is Fc1cccc2c1sc1c(Cl)ncnc12. |
| Q: What is the molecular weight of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: Molecular weight of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is 238.67. |
| Q: What is the Chinese name of 2098009-57-3? |
| A: Chinese name of 2098009-57-3 is 2098009-57-3. |
| Q: What is the InChIKey of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: InChIKey of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is BVLXNKPEXNGKQD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: Molecular formula of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is C10H4ClFN2S. |
| Q: What is the CAS number of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine? |
| A: CAS number of 4-Chloro-6-fluorobenzo[4,5]thieno[3,2-d]pyrimidine is 2098009-57-3. |