4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride
Modify Date: 2026-07-28 12:56:53
![4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride Structure](https://www.chemsrc.com/extcaspic/106/2098024-08-7.png)
4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride structure
|
Common Name | 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2098024-08-7 | Molecular Weight | 220.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14ClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14ClFN2O |
|---|---|
| Molecular Weight | 220.67 |
| InChIKey | JQRGCKMRQYKETO-UHFFFAOYSA-N |
| SMILES | Cc1noc(C)c1CC1(F)CNC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: CAS number of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is 2098024-08-7. |
| Q: What is the molecular weight of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: Molecular weight of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is 220.67. |
| Q: What is the SMILES notation of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: SMILES notation of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is Cc1noc(C)c1CC1(F)CNC1.Cl. |
| Q: What is the InChIKey of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: InChIKey of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is JQRGCKMRQYKETO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098024-08-7? |
| A: Chinese name of 2098024-08-7 is 2098024-08-7. |
| Q: What is the molecular formula of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: Molecular formula of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is C9H14ClFN2O. |
| Q: What is the English name of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride? |
| A: The English name of 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride is 4-[(3-Fluoroazetidin-3-yl)methyl]-3,5-dimethyl-1,2-oxazole hydrochloride. |