ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2098028-43-2 | Molecular Weight | 227.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N3O2S |
|---|---|
| Molecular Weight | 227.29 |
| InChIKey | CCRZNCWBVSXTSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cn(C2CCSC2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the molecular formula of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is C9H13N3O2S. |
| Q: What is the Chinese name of 2098028-43-2? |
| A: Chinese name of 2098028-43-2 is 2098028-43-2. |
| Q: What is the InChIKey of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is CCRZNCWBVSXTSH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is CCOC(=O)c1cn(C2CCSC2)nn1. |
| Q: What is the CAS number of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is 2098028-43-2. |
| Q: What is the molecular weight of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of ethyl 1-(thiolan-3-yl)-1H-1,2,3-triazole-4-carboxylate is 227.29. |