1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole
Modify Date: 2026-07-27 22:58:44
1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole structure
|
Common Name | 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 2098028-58-9 | Molecular Weight | 242.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9Cl2N3 |
|---|---|
| Molecular Weight | 242.10 |
| InChIKey | FGOXCAMQRTYKCQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Cl)c1-n1cc(CCl)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: InChIKey of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is FGOXCAMQRTYKCQ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: The English name of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole. |
| Q: What is the molecular formula of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: Molecular formula of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is C10H9Cl2N3. |
| Q: What is the molecular weight of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: Molecular weight of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is 242.10. |
| Q: What is the CAS number of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: CAS number of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is 2098028-58-9. |
| Q: What is the Chinese name of 2098028-58-9? |
| A: Chinese name of 2098028-58-9 is 2098028-58-9. |
| Q: What is the SMILES notation of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole? |
| A: SMILES notation of 1-(2-chloro-6-methylphenyl)-4-(chloromethyl)-1H-1,2,3-triazole is Cc1cccc(Cl)c1-n1cc(CCl)nn1. |