2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid
Modify Date: 2026-09-29 23:05:19
![2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid Structure](https://www.chemsrc.com/extcaspic/036/2098031-79-7.png)
2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid structure
|
Common Name | 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2098031-79-7 | Molecular Weight | 226.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N2O3S |
|---|---|
| Molecular Weight | 226.25 |
| InChIKey | ZRIMYXQLWQDOJJ-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc2c(nn1)CCSC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: InChIKey of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is ZRIMYXQLWQDOJJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098031-79-7? |
| A: Chinese name of 2098031-79-7 is 2098031-79-7. |
| Q: What is the CAS number of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: CAS number of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is 2098031-79-7. |
| Q: What is the English name of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: The English name of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid. |
| Q: What is the SMILES notation of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: SMILES notation of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is O=C(O)COc1cc2c(nn1)CCSC2. |
| Q: What is the molecular formula of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: Molecular formula of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is C9H10N2O3S. |
| Q: What is the molecular weight of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid? |
| A: Molecular weight of 2-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yloxy}acetic acid is 226.25. |