2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid
Modify Date: 2026-07-06 19:14:13
![2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid Structure](https://www.chemsrc.com/extcaspic/155/2098036-65-6.png)
2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid structure
|
Common Name | 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2098036-65-6 | Molecular Weight | 223.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17N3O2 |
|---|---|
| Molecular Weight | 223.27 |
| InChIKey | VPZQCPDJRSIUPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1cc(NCC(=O)O)ncn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: Molecular formula of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is C11H17N3O2. |
| Q: What is the English name of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: The English name of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid. |
| Q: What is the molecular weight of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: Molecular weight of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is 223.27. |
| Q: What is the SMILES notation of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: SMILES notation of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is CC(C)(C)Cc1cc(NCC(=O)O)ncn1. |
| Q: What is the InChIKey of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: InChIKey of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is VPZQCPDJRSIUPD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid? |
| A: CAS number of 2-{[6-(2,2-Dimethylpropyl)pyrimidin-4-yl]amino}acetic acid is 2098036-65-6. |
| Q: What is the Chinese name of 2098036-65-6? |
| A: Chinese name of 2098036-65-6 is 2098036-65-6. |