4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine
Modify Date: 2025-08-23 16:25:12
4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine structure
|
Common Name | 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine | ||
|---|---|---|---|---|
| CAS Number | 2098047-92-6 | Molecular Weight | 240.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H28N2O |
|---|---|
| Molecular Weight | 240.38 |
| InChIKey | UGKBOUNINFZZAT-UHFFFAOYSA-N |
| SMILES | CCOCC1(C)CCN(C2CCNCC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: CAS number of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is 2098047-92-6. |
| Q: What is the SMILES notation of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: SMILES notation of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is CCOCC1(C)CCN(C2CCNCC2)CC1. |
| Q: What is the InChIKey of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: InChIKey of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is UGKBOUNINFZZAT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098047-92-6? |
| A: Chinese name of 2098047-92-6 is 2098047-92-6. |
| Q: What is the molecular weight of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: Molecular weight of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is 240.38. |
| Q: What is the English name of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: The English name of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine. |
| Q: What is the molecular formula of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine? |
| A: Molecular formula of 4-(Ethoxymethyl)-4-methyl-1,4'-bipiperidine is C14H28N2O. |