4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine
Modify Date: 2026-09-27 18:21:15
![4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine Structure](https://www.chemsrc.com/extcaspic/058/2098051-97-7.png)
4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine structure
|
Common Name | 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 2098051-97-7 | Molecular Weight | 247.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClFN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7ClFN3 |
|---|---|
| Molecular Weight | 247.65 |
| InChIKey | IXZNKYHNQWNOFF-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1-c1cc2c(Cl)nccn2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: Molecular formula of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is C12H7ClFN3. |
| Q: What is the Chinese name of 2098051-97-7? |
| A: Chinese name of 2098051-97-7 is 2098051-97-7. |
| Q: What is the CAS number of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: CAS number of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is 2098051-97-7. |
| Q: What is the English name of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: The English name of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine. |
| Q: What is the InChIKey of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: InChIKey of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is IXZNKYHNQWNOFF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: Molecular weight of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is 247.65. |
| Q: What is the SMILES notation of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine? |
| A: SMILES notation of 4-Chloro-2-(2-fluorophenyl)pyrazolo[1,5-a]pyrazine is Fc1ccccc1-c1cc2c(Cl)nccn2n1. |