1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide structure
|
Common Name | 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide | ||
|---|---|---|---|---|
| CAS Number | 2098053-13-3 | Molecular Weight | 255.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO3S |
|---|---|
| Molecular Weight | 255.34 |
| InChIKey | OGLKHGRXAACKQY-UHFFFAOYSA-N |
| SMILES | CCCCN1c2ccccc2C(O)CS1(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: The English name of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide. |
| Q: What is the CAS number of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: CAS number of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 2098053-13-3. |
| Q: What is the SMILES notation of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: SMILES notation of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is CCCCN1c2ccccc2C(O)CS1(=O)=O. |
| Q: What is the Chinese name of 2098053-13-3? |
| A: Chinese name of 2098053-13-3 is 2098053-13-3. |
| Q: What is the InChIKey of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: InChIKey of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is OGLKHGRXAACKQY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: Molecular formula of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is C12H17NO3S. |
| Q: What is the molecular weight of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide? |
| A: Molecular weight of 1-butyl-4-hydroxy-3,4-dihydro-1H-benzo[c][1,2]thiazine 2,2-dioxide is 255.34. |