3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole
Modify Date: 2026-07-11 18:50:47
![3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole Structure](https://www.chemsrc.com/extcaspic/099/2098058-80-9.png)
3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole structure
|
Common Name | 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 2098058-80-9 | Molecular Weight | 235.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21N3O |
|---|---|
| Molecular Weight | 235.33 |
| InChIKey | DGTSBGYJZSGIKC-UHFFFAOYSA-N |
| SMILES | CCc1noc(C2CNCC23CCCCC3)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: The English name of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole. |
| Q: What is the CAS number of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: CAS number of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is 2098058-80-9. |
| Q: What is the molecular weight of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: Molecular weight of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is 235.33. |
| Q: What is the Chinese name of 2098058-80-9? |
| A: Chinese name of 2098058-80-9 is 2098058-80-9. |
| Q: What is the SMILES notation of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: SMILES notation of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is CCc1noc(C2CNCC23CCCCC3)n1. |
| Q: What is the molecular formula of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: Molecular formula of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is C13H21N3O. |
| Q: What is the InChIKey of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole? |
| A: InChIKey of 3-Ethyl-5-(2-azaspiro[4.5]decan-4-yl)-1,2,4-oxadiazole is DGTSBGYJZSGIKC-UHFFFAOYSA-N. |