2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile
Modify Date: 2026-09-27 10:37:13
![2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile Structure](https://www.chemsrc.com/extcaspic/200/2098066-65-8.png)
2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile structure
|
Common Name | 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 2098066-65-8 | Molecular Weight | 203.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4F3N3O |
|---|---|
| Molecular Weight | 203.12 |
| InChIKey | YCNIZOGPMAJKCH-UHFFFAOYSA-N |
| SMILES | N#CCn1cc(C(=O)C(F)(F)F)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: The English name of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile. |
| Q: What is the molecular weight of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: Molecular weight of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is 203.12. |
| Q: What is the Chinese name of 2098066-65-8? |
| A: Chinese name of 2098066-65-8 is 2098066-65-8. |
| Q: What is the SMILES notation of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: SMILES notation of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is N#CCn1cc(C(=O)C(F)(F)F)cn1. |
| Q: What is the molecular formula of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: Molecular formula of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is C7H4F3N3O. |
| Q: What is the InChIKey of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: InChIKey of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is YCNIZOGPMAJKCH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile? |
| A: CAS number of 2-[4-(2,2,2-trifluoroacetyl)-1H-pyrazol-1-yl]acetonitrile is 2098066-65-8. |