ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate
Modify Date: 2025-09-09 23:45:25
![ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate Structure](https://www.chemsrc.com/extcaspic/145/2098072-02-5.png)
ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate structure
|
Common Name | ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 2098072-02-5 | Molecular Weight | 251.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21N3O2 |
|---|---|
| Molecular Weight | 251.32 |
| InChIKey | ORJXYNFNMZIAJG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCn1cc(C2CCNCC2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: CAS number of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is 2098072-02-5. |
| Q: What is the molecular formula of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: Molecular formula of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is C13H21N3O2. |
| Q: What is the InChIKey of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: InChIKey of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is ORJXYNFNMZIAJG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: Molecular weight of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is 251.32. |
| Q: What is the Chinese name of 2098072-02-5? |
| A: Chinese name of 2098072-02-5 is 2098072-02-5. |
| Q: What is the English name of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: The English name of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate. |
| Q: What is the SMILES notation of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate? |
| A: SMILES notation of ethyl 3-[4-(piperidin-4-yl)-1H-pyrazol-1-yl]propanoate is CCOC(=O)CCn1cc(C2CCNCC2)cn1. |