1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate
Modify Date: 2026-09-21 22:28:31
1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate structure
|
Common Name | 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2098081-83-3 | Molecular Weight | 342.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H34N2O4 |
|---|---|
| Molecular Weight | 342.5 |
| InChIKey | DQXSUXZVXGYBMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCC1NCCC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: Molecular formula of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is C18H34N2O4. |
| Q: What is the SMILES notation of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: SMILES notation of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCC1NCCC(C)C. |
| Q: What is the Chinese name of 2098081-83-3? |
| A: Chinese name of 2098081-83-3 is 2098081-83-3. |
| Q: What is the English name of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: The English name of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate. |
| Q: What is the molecular weight of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: Molecular weight of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is 342.5. |
| Q: What is the CAS number of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: CAS number of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is 2098081-83-3. |
| Q: What is the InChIKey of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate? |
| A: InChIKey of 1-(Tert-butyl) 3-ethyl 4-(isopentylamino)piperidine-1,3-dicarboxylate is DQXSUXZVXGYBMX-UHFFFAOYSA-N. |