1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine
Modify Date: 2026-07-09 19:13:56
![1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine Structure](https://www.chemsrc.com/extcaspic/439/2098087-91-1.png)
1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine structure
|
Common Name | 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine | ||
|---|---|---|---|---|
| CAS Number | 2098087-91-1 | Molecular Weight | 236.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N4S |
|---|---|
| Molecular Weight | 236.34 |
| InChIKey | HCUUBJQVLSJPDZ-UHFFFAOYSA-N |
| SMILES | c1c(N2CCNCC2)nnc2c1CSCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: InChIKey of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is HCUUBJQVLSJPDZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098087-91-1? |
| A: Chinese name of 2098087-91-1 is 2098087-91-1. |
| Q: What is the CAS number of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: CAS number of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is 2098087-91-1. |
| Q: What is the SMILES notation of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: SMILES notation of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is c1c(N2CCNCC2)nnc2c1CSCC2. |
| Q: What is the English name of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: The English name of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine. |
| Q: What is the molecular weight of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: Molecular weight of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is 236.34. |
| Q: What is the molecular formula of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine? |
| A: Molecular formula of 1-{5H,7H,8H-thiopyrano[4,3-c]pyridazin-3-yl}piperazine is C11H16N4S. |