Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate
Modify Date: 2026-08-19 10:03:26
![Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate Structure](https://www.chemsrc.com/extcaspic/332/2098103-64-9.png)
Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate structure
|
Common Name | Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate | ||
|---|---|---|---|---|
| CAS Number | 2098103-64-9 | Molecular Weight | 223.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17N3O2 |
|---|---|
| Molecular Weight | 223.27 |
| InChIKey | ZPQMJNNFUCBHMT-UHFFFAOYSA-N |
| SMILES | COC(=O)CNc1cc(CC(C)C)ncn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: Molecular formula of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is C11H17N3O2. |
| Q: What is the molecular weight of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: Molecular weight of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is 223.27. |
| Q: What is the InChIKey of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: InChIKey of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is ZPQMJNNFUCBHMT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098103-64-9? |
| A: Chinese name of 2098103-64-9 is 2098103-64-9. |
| Q: What is the English name of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: The English name of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate. |
| Q: What is the CAS number of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: CAS number of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is 2098103-64-9. |
| Q: What is the SMILES notation of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate? |
| A: SMILES notation of Methyl 2-{[6-(2-methylpropyl)pyrimidin-4-yl]amino}acetate is COC(=O)CNc1cc(CC(C)C)ncn1. |