3-Isobutyl-[1,4'-bipiperidin]-4-ol
Modify Date: 2026-07-18 12:29:16
![3-Isobutyl-[1,4'-bipiperidin]-4-ol Structure](https://www.chemsrc.com/extcaspic/445/2098104-38-0.png)
3-Isobutyl-[1,4'-bipiperidin]-4-ol structure
|
Common Name | 3-Isobutyl-[1,4'-bipiperidin]-4-ol | ||
|---|---|---|---|---|
| CAS Number | 2098104-38-0 | Molecular Weight | 240.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Isobutyl-[1,4'-bipiperidin]-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H28N2O |
|---|---|
| Molecular Weight | 240.38 |
| InChIKey | WOPXZLYJMAQCBK-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CN(C2CCNCC2)CCC1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: SMILES notation of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is CC(C)CC1CN(C2CCNCC2)CCC1O. |
| Q: What is the molecular formula of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: Molecular formula of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is C14H28N2O. |
| Q: What is the CAS number of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: CAS number of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is 2098104-38-0. |
| Q: What is the molecular weight of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: Molecular weight of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is 240.38. |
| Q: What is the InChIKey of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: InChIKey of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is WOPXZLYJMAQCBK-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Isobutyl-[1,4'-bipiperidin]-4-ol? |
| A: The English name of 3-Isobutyl-[1,4'-bipiperidin]-4-ol is 3-Isobutyl-[1,4'-bipiperidin]-4-ol. |
| Q: What is the Chinese name of 2098104-38-0? |
| A: Chinese name of 2098104-38-0 is 2098104-38-0. |