2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid
Modify Date: 2026-08-28 18:24:23
2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid structure
|
Common Name | 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2098121-39-0 | Molecular Weight | 237.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO3 |
|---|---|
| Molecular Weight | 237.29 |
| InChIKey | QJUNLVAADMTJNC-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)CCC2(C(=O)O)CCCC=C12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: CAS number of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is 2098121-39-0. |
| Q: What is the Chinese name of 2098121-39-0? |
| A: Chinese name of 2098121-39-0 is 2098121-39-0. |
| Q: What is the SMILES notation of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: SMILES notation of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is CCCN1C(=O)CCC2(C(=O)O)CCCC=C12. |
| Q: What is the molecular weight of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: Molecular weight of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is 237.29. |
| Q: What is the InChIKey of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: InChIKey of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is QJUNLVAADMTJNC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: Molecular formula of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is C13H19NO3. |
| Q: What is the English name of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid? |
| A: The English name of 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid is 2-oxo-1-propyl-1,3,4,5,6,7-hexahydroquinoline-4a(2H)-carboxylic acid. |