5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride
Modify Date: 2025-08-28 17:42:21
![5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride Structure](https://www.chemsrc.com/extcaspic/217/2098135-24-9.png)
5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride structure
|
Common Name | 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2098135-24-9 | Molecular Weight | 204.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H17ClN2O |
|---|---|
| Molecular Weight | 204.70 |
| InChIKey | GVIOQXQXXCVSLK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2(CNC2)C1(C)C.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: The English name of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride. |
| Q: What is the molecular formula of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: Molecular formula of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is C9H17ClN2O. |
| Q: What is the InChIKey of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: InChIKey of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is GVIOQXQXXCVSLK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2098135-24-9? |
| A: Chinese name of 2098135-24-9 is 2098135-24-9. |
| Q: What is the molecular weight of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: Molecular weight of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is 204.70. |
| Q: What is the CAS number of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: CAS number of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is 2098135-24-9. |
| Q: What is the SMILES notation of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride? |
| A: SMILES notation of 5,5,6-Trimethyl-2,6-diazaspiro[3.4]octan-7-one hydrochloride is CN1C(=O)CC2(CNC2)C1(C)C.Cl. |