4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride
Modify Date: 2026-09-27 21:44:46
![4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride Structure](https://www.chemsrc.com/extcaspic/262/2098156-72-8.png)
4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride structure
|
Common Name | 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2098156-72-8 | Molecular Weight | 231.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22ClNO |
|---|---|
| Molecular Weight | 231.76 |
| InChIKey | CNFUMQBMEPBWNL-TYYBGVCCSA-N |
| SMILES | C(=CC1CCOCC1)C1CCNCC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: InChIKey of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is CNFUMQBMEPBWNL-TYYBGVCCSA-N. |
| Q: What is the molecular weight of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: Molecular weight of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is 231.76. |
| Q: What is the CAS number of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: CAS number of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is 2098156-72-8. |
| Q: What is the Chinese name of 2098156-72-8? |
| A: Chinese name of 2098156-72-8 is 2098156-72-8. |
| Q: What is the molecular formula of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: Molecular formula of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is C12H22ClNO. |
| Q: What is the SMILES notation of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: SMILES notation of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is C(=CC1CCOCC1)C1CCNCC1.Cl. |
| Q: What is the English name of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride? |
| A: The English name of 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride is 4-[(E)-2-(oxan-4-yl)ethenyl]piperidine hydrochloride. |