bis(4-hydroxybutyl) hexanedioate structure
|
Common Name | bis(4-hydroxybutyl) hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 20985-13-1 | Molecular Weight | 290.35300 | |
| Density | 1.109g/cm3 | Boiling Point | 423.2ºC at 760mmHg | |
| Molecular Formula | C14H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.7ºC | |
| Name | bis(4-hydroxybutyl) hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760mmHg |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.35300 |
| Flash Point | 148.7ºC |
| Exact Mass | 290.17300 |
| PSA | 93.06000 |
| LogP | 1.17820 |
| Vapour Pressure | 6.18E-09mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | MIPAMDMBINCYQD-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCCCCO)OCCCCO |
| HS Code | 2918199090 |
|---|
|
~%
bis(4-hydroxybu... CAS#:20985-13-1 |
| Literature: Zil'berman,E.N.; Kulikova,A.E. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, p. 3999 - 4002,3956 - 3959 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 244-138-1 |