3-[(4-Methylpiperidino)methyl]-1H-indole structure
|
Common Name | 3-[(4-Methylpiperidino)methyl]-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 21000-95-3 | Molecular Weight | 228.33300 | |
| Density | 1.096g/cm3 | Boiling Point | 370.5ºC at 760 mmHg | |
| Molecular Formula | C15H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | 3-[(4-methylpiperidin-1-yl)methyl]-1H-indole |
|---|
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 370.5ºC at 760 mmHg |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.33300 |
| Flash Point | 177.9ºC |
| Exact Mass | 228.16300 |
| PSA | 19.03000 |
| LogP | 3.33770 |
| Vapour Pressure | 1.1E-05mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | DGCGMYNLCDVYMB-UHFFFAOYSA-N |
| SMILES | CC1CCN(Cc2c[nH]c3ccccc23)CC1 |
| HS Code | 2933990090 |
|---|
|
~79%
3-[(4-Methylpip... CAS#:21000-95-3 |
| Literature: Todd, Robert; Hossain, M. Mahmun Synthesis, 2009 , # 11 art. no. M07508SS, p. 1846 - 1850 |
|
~97%
3-[(4-Methylpip... CAS#:21000-95-3 |
| Literature: Rafiee, Ezzat; Eavani, Sara; Malaekeh-Nikouei, Bizhan Chemistry Letters, 2012 , vol. 41, # 4 p. 438 - 440 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |