diisothiocyanato(diphenyl)stannane structure
|
Common Name | diisothiocyanato(diphenyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 21001-81-0 | Molecular Weight | 389.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2S2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diisothiocyanato(diphenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10N2S2Sn |
|---|---|
| Molecular Weight | 389.07400 |
| Exact Mass | 389.93100 |
| PSA | 64.18000 |
| LogP | 3.91000 |
| InChIKey | VBBLHFYJSABZTA-UHFFFAOYSA-N |
| SMILES | S=C=N[Sn](N=C=S)(c1ccccc1)c1ccccc1 |
|
~%
diisothiocyanat... CAS#:21001-81-0 |
| Literature: Rupainwar, Rajeshwari; Pandey, B. D. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 600 - 602 |
|
~%
diisothiocyanat... CAS#:21001-81-0 |
| Literature: Gabe, E. J.; Prasad, L.; Page, Y. Le; Smith, F. E. Acta Crystallographica, Section B: Structural Crystallography and Crystal Chemistry, 1982 , vol. 38, p. 256 - 258 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,diisothiocyanatodiphenyl |
| diphenyltin diisothiocyanate |