2-(3-hydroxyanilino)benzoic acid structure
|
Common Name | 2-(3-hydroxyanilino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21003-78-1 | Molecular Weight | 229.23100 | |
| Density | 1.377g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | 2-(3-hydroxyanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23100 |
| Flash Point | 211.7ºC |
| Exact Mass | 229.07400 |
| PSA | 69.56000 |
| LogP | 2.90700 |
| Vapour Pressure | 4.93E-08mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | YQULREKUYCCSJA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cccc(O)c1 |
| HS Code | 2922509090 |
|---|
|
~48%
2-(3-hydroxyani... CAS#:21003-78-1 |
| Literature: Chalmers; Scholz; Topliss; Kolliniatis; Munro; Craik; Iskander; Stockigt Journal of Medicinal Chemistry, 1993 , vol. 36, # 9 p. 1272 - 1277 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-Hydroxy-phenyl)-anthranilic acid |
| N-(m-Hydroxyphenyl)anthranilic acid |
| Anthranilic acid,N-(m-hydroxyphenyl) |