Bis-PEG4-t-butyl ester
Modify Date: 2025-08-27 17:59:59
Bis-PEG4-t-butyl ester structure
|
Common Name | Bis-PEG4-t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 2100306-53-2 | Molecular Weight | 406.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H38O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-PEG4-t-butyl esterBis-PEG4-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Bis-PEG4-t-butyl ester |
|---|
| Description | Bis-PEG4-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C20H38O8 |
|---|---|
| Molecular Weight | 406.51 |
| InChIKey | BEMRKFMWPQHBBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCC(=O)OC(C)(C)C |