N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate
Modify Date: 2026-08-07 09:47:12
N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate structure
|
Common Name | N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate | ||
|---|---|---|---|---|
| CAS Number | 2102408-56-8 | Molecular Weight | 380.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H28N2O9 |
|---|---|
| Molecular Weight | 380.39 |
| InChIKey | SAGHHOIPMFNAQH-UHFFFAOYSA-N |
| SMILES | CN(CCCN)C(=O)OC(C)(C)C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: The English name of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate. |
| Q: What is the molecular formula of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: Molecular formula of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is C15H28N2O9. |
| Q: What is the InChIKey of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: InChIKey of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is SAGHHOIPMFNAQH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: Molecular weight of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is 380.39. |
| Q: What is the SMILES notation of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: SMILES notation of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is CN(CCCN)C(=O)OC(C)(C)C.O=C(O)CC(O)(CC(=O)O)C(=O)O. |
| Q: What is the Chinese name of 2102408-56-8? |
| A: Chinese name of 2102408-56-8 is 2102408-56-8. |
| Q: What is the CAS number of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate? |
| A: CAS number of N-(3-Aminopropyl)-N-methylcarbamic acid tert-butyl ester citrate is 2102408-56-8. |